2,5-Dimethoxy-4-propylamphetamine

| CAS_number = 63779-88-4 | CAS_supplemental =
53581-55-8 (hydrochloride) | UNII_Ref = | UNII = L3P287BI9W | PubChem = 542051 | DrugBank_Ref = | DrugBank = | ChemSpiderID_Ref = | ChemSpiderID = 472021 | ChEMBL_Ref = | ChEMBL = 8569 | synonyms = 2,5-Dimethoxy-4-propylamphetamine; 4-Propyl-2,5-dimethoxyamphetamine; DOPR; DOPr

| IUPAC_name = 1-(2,5-dimethoxy-4-propylphenyl)propan-2-amine | C=14 | H=23 | N=1 | O=2 | SMILES = CCCC1=CC(=C(C=C1OC)CC(C)N)OC | StdInChI_Ref = | StdInChI = 1S/C15H25NO2/c1-5-6-11-8-14(17-4)12(7-10(2)15)9-13(11)16-3/h8-10H,5-7,15H2,1-4H3 | StdInChIKey_Ref = | StdInChIKey = UEEAUFJYLUJWQJ-UHFFFAOYSA-N }}

2,5-Dimethoxy-4-propylamphetamine (DOPR) is a psychedelic drug of the phenethylamine, amphetamine, and DOx families related to DOM. It is the derivative of DOM in which the methyl group at the 4 position has been replaced with a propyl group. The drug is taken orally.

The drug acts as a serotonin receptor agonist, including of the serotonin 5-HT_2A receptor. It produces psychedelic-like effects in animals.

DOPR was first described in the literature by Alexander Shulgin in 1970. Subsequently, it was described in greater detail by Shulgin in his 1991 book ''PiHKAL'' (''Phenethylamines I Have Known and Loved''). Provided by Wikipedia